C20H29N5O3S — CID 144922099
ethane;methane;N-[3-[(5-methyl-1H-pyrazol-3-yl)sulfinylamino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 144922099) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is ethane;methane;N-[3-[(5-methyl-1H-pyrazol-3-yl)sulfinylamino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | ethane;methane;N-[3-[(5-methyl-1H-pyrazol-3-yl)sulfinylamino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 144922099 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | ethane;methane;N-[3-[(5-methyl-1H-pyrazol-3-yl)sulfinylamino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | C.CC.Cc1cc(S(=O)NCCCNC(=O)c2cc(-c3ccccc3)on2)n[nH]1 |
| InChI | InChI=1S/C17H19N5O3S.C2H6.CH4/c1-12-10-16(21-20-12)26(24)19-9-5-8-18-17(23)14-11-15(25-22-14)13-6-3-2-4-7-13;1-2;/h2-4,6-7,10-11,19H,5,8-9H2,1H3,(H,18,23)(H,20,21);1-2H3;1H4 |
| InChIKey | CRVBURSYYLBXRB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|