C21H24N6O — CID 4534225
N-(3-morpholin-4-ylpropyl)-6-pyridin-2-yl-2-pyridin-4-ylpyrimidin-4-amine (PubChem CID 4534225) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-6-pyridin-2-yl-2-pyridin-4-ylpyrimidin-4-amine.
| Compound Name | N-(3-morpholin-4-ylpropyl)-6-pyridin-2-yl-2-pyridin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 4534225 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-6-pyridin-2-yl-2-pyridin-4-ylpyrimidin-4-amine |
| SMILES | c1ccc(-c2cc(NCCCN3CCOCC3)nc(-c3ccncc3)n2)nc1 |
| InChI | InChI=1S/C21H24N6O/c1-2-7-23-18(4-1)19-16-20(24-8-3-11-27-12-14-28-15-13-27)26-21(25-19)17-5-9-22-10-6-17/h1-2,4-7,9-10,16H,3,8,11-15H2,(H,24,25,26) |
| InChIKey | ABYIYHCAZTYTNQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|