C20H23N5OS — CID 92577605
N-(3-morpholin-4-ylpropyl)-5-pyridin-2-yl-4-thiophen-2-ylpyrimidin-2-amine (PubChem CID 92577605) has the molecular formula C20H23N5OS and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-5-pyridin-2-yl-4-thiophen-2-ylpyrimidin-2-amine.
| Compound Name | N-(3-morpholin-4-ylpropyl)-5-pyridin-2-yl-4-thiophen-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 92577605 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-5-pyridin-2-yl-4-thiophen-2-ylpyrimidin-2-amine |
| SMILES | c1ccc(-c2cnc(NCCCN3CCOCC3)nc2-c2cccs2)nc1 |
| InChI | InChI=1S/C20H23N5OS/c1-2-7-21-17(5-1)16-15-23-20(24-19(16)18-6-3-14-27-18)22-8-4-9-25-10-12-26-13-11-25/h1-3,5-7,14-15H,4,8-13H2,(H,22,23,24) |
| InChIKey | GRMREAHDNVYXSZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|