C21H23N5O3S — CID 92571988
5-(1,3-benzodioxol-5-yl)-N-(3-morpholin-4-ylpropyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine (PubChem CID 92571988) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-(3-morpholin-4-ylpropyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-(3-morpholin-4-ylpropyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 92571988 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-(3-morpholin-4-ylpropyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
| SMILES | c1csc(-c2nc(NCCCN3CCOCC3)ncc2-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C21H23N5O3S/c1(6-26-7-9-27-10-8-26)4-23-21-24-13-16(19(25-21)20-22-5-11-30-20)15-2-3-17-18(12-15)29-14-28-17/h2-3,5,11-13H,1,4,6-10,14H2,(H,23,24,25) |
| InChIKey | GWHOMPAEKUDGEW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|