C13H18N4OS — CID 91801780
N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrimidin-2-amine (PubChem CID 91801780) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91801780 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrimidin-2-amine |
| SMILES | c1cc2nc(NCCCN3CCOCC3)ncc2s1 |
| InChI | InChI=1S/C13H18N4OS/c1(4-17-5-7-18-8-6-17)3-14-13-15-10-12-11(16-13)2-9-19-12/h2,9-10H,1,3-8H2,(H,14,15,16) |
| InChIKey | GSTTVIOPAXHQDN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|