C19H21N5OS — CID 92571387
N-(2-morpholin-4-ylethyl)-5-pyridin-4-yl-4-thiophen-2-ylpyrimidin-2-amine (PubChem CID 92571387) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-5-pyridin-4-yl-4-thiophen-2-ylpyrimidin-2-amine.
| Compound Name | N-(2-morpholin-4-ylethyl)-5-pyridin-4-yl-4-thiophen-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 92571387 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-5-pyridin-4-yl-4-thiophen-2-ylpyrimidin-2-amine |
| SMILES | c1csc(-c2nc(NCCN3CCOCC3)ncc2-c2ccncc2)c1 |
| InChI | InChI=1S/C19H21N5OS/c1-2-17(26-13-1)18-16(15-3-5-20-6-4-15)14-22-19(23-18)21-7-8-24-9-11-25-12-10-24/h1-6,13-14H,7-12H2,(H,21,22,23) |
| InChIKey | GQNTVGULCSLLBL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |