C15H18N6OS — CID 117090345
N-(2-morpholin-4-ylethyl)-8-thiophen-2-yl-7H-purin-6-amine (PubChem CID 117090345) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-8-thiophen-2-yl-7H-purin-6-amine.
| Compound Name | N-(2-morpholin-4-ylethyl)-8-thiophen-2-yl-7H-purin-6-amine |
|---|---|
| PubChem CID | 117090345 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-8-thiophen-2-yl-7H-purin-6-amine |
| SMILES | c1csc(-c2nc3ncnc(NCCN4CCOCC4)c3[nH]2)c1 |
| InChI | InChI=1S/C15H18N6OS/c1-2-11(23-9-1)13-19-12-14(17-10-18-15(12)20-13)16-3-4-21-5-7-22-8-6-21/h1-2,9-10H,3-8H2,(H2,16,17,18,19,20) |
| InChIKey | FZAFIDXQUCUOGF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |