C18H24N6OS — CID 117090219
N-(2-morpholin-4-ylethyl)-9-propan-2-yl-8-thiophen-2-ylpurin-6-amine (PubChem CID 117090219) has the molecular formula C18H24N6OS and a molecular weight of 372.50 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-9-propan-2-yl-8-thiophen-2-ylpurin-6-amine.
| Compound Name | N-(2-morpholin-4-ylethyl)-9-propan-2-yl-8-thiophen-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 117090219 |
| Molecular Formula | C18H24N6OS |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-9-propan-2-yl-8-thiophen-2-ylpurin-6-amine |
| SMILES | CC(C)n1c(-c2cccs2)nc2c(NCCN3CCOCC3)ncnc21 |
| InChI | InChI=1S/C18H24N6OS/c1-13(2)24-17(14-4-3-11-26-14)22-15-16(20-12-21-18(15)24)19-5-6-23-7-9-25-10-8-23/h3-4,11-13H,5-10H2,1-2H3,(H,19,20,21) |
| InChIKey | WOFCQTXOWHPVOX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |