C25H29N7O2 — CID 117081260
4-[2-[[8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol (PubChem CID 117081260) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[2-[[8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117081260 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 4-[2-[[8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol |
| SMILES | CC(C)n1c(-c2ccc(N3CCOCC3)nc2)nc2c(NCCc3ccc(O)cc3)ncnc21 |
| InChI | InChI=1S/C25H29N7O2/c1-17(2)32-24(19-5-8-21(27-15-19)31-11-13-34-14-12-31)30-22-23(28-16-29-25(22)32)26-10-9-18-3-6-20(33)7-4-18/h3-8,15-17,33H,9-14H2,1-2H3,(H,26,28,29) |
| InChIKey | LJZQJCLLBGBHQE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |