C24H30N8O — CID 117081075
N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-8-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine (PubChem CID 117081075) has the molecular formula C24H30N8O and a molecular weight of 446.56 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-8-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-8-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine |
|---|---|
| PubChem CID | 117081075 |
| Molecular Formula | C24H30N8O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-9-propan-2-yl-8-(1,3,5-trimethylpyrazol-4-yl)purin-6-amine |
| SMILES | Cc1nn(C)c(C)c1-c1nc2c(Nc3ccc(N4CCOCC4)cc3)ncnc2n1C(C)C |
| InChI | InChI=1S/C24H30N8O/c1-15(2)32-23(20-16(3)29-30(5)17(20)4)28-21-22(25-14-26-24(21)32)27-18-6-8-19(9-7-18)31-10-12-33-13-11-31/h6-9,14-15H,10-13H2,1-5H3,(H,25,26,27) |
| InChIKey | FQWJXYCPVDBOIM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|