C24H27N7O — CID 117092748
8-N-(4-morpholin-4-ylphenyl)-6-N-phenyl-9-propan-2-ylpurine-6,8-diamine (PubChem CID 117092748) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 8-N-(4-morpholin-4-ylphenyl)-6-N-phenyl-9-propan-2-ylpurine-6,8-diamine.
| Compound Name | 8-N-(4-morpholin-4-ylphenyl)-6-N-phenyl-9-propan-2-ylpurine-6,8-diamine |
|---|---|
| PubChem CID | 117092748 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 8-N-(4-morpholin-4-ylphenyl)-6-N-phenyl-9-propan-2-ylpurine-6,8-diamine |
| SMILES | CC(C)n1c(Nc2ccc(N3CCOCC3)cc2)nc2c(Nc3ccccc3)ncnc21 |
| InChI | InChI=1S/C24H27N7O/c1-17(2)31-23-21(22(25-16-26-23)27-18-6-4-3-5-7-18)29-24(31)28-19-8-10-20(11-9-19)30-12-14-32-15-13-30/h3-11,16-17H,12-15H2,1-2H3,(H,28,29)(H,25,26,27) |
| InChIKey | AZLZJEBSQPEMLN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|