C23H26N8 — CID 117082889
N-phenyl-9-propan-2-yl-8-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine (PubChem CID 117082889) has the molecular formula C23H26N8 and a molecular weight of 414.52 g/mol. Its IUPAC name is N-phenyl-9-propan-2-yl-8-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine.
| Compound Name | N-phenyl-9-propan-2-yl-8-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 117082889 |
| Molecular Formula | C23H26N8 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-phenyl-9-propan-2-yl-8-(4-pyridin-2-ylpiperazin-1-yl)purin-6-amine |
| SMILES | CC(C)n1c(N2CCN(c3ccccn3)CC2)nc2c(Nc3ccccc3)ncnc21 |
| InChI | InChI=1S/C23H26N8/c1-17(2)31-22-20(21(25-16-26-22)27-18-8-4-3-5-9-18)28-23(31)30-14-12-29(13-15-30)19-10-6-7-11-24-19/h3-11,16-17H,12-15H2,1-2H3,(H,25,26,27) |
| InChIKey | JJAOCMZFRHZZKD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |