C19H20N8 — CID 117078939
6-N-benzyl-9-propan-2-yl-8-N-pyrimidin-2-ylpurine-6,8-diamine (PubChem CID 117078939) has the molecular formula C19H20N8 and a molecular weight of 360.43 g/mol. Its IUPAC name is 6-N-benzyl-9-propan-2-yl-8-N-pyrimidin-2-ylpurine-6,8-diamine.
| Compound Name | 6-N-benzyl-9-propan-2-yl-8-N-pyrimidin-2-ylpurine-6,8-diamine |
|---|---|
| PubChem CID | 117078939 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-N-benzyl-9-propan-2-yl-8-N-pyrimidin-2-ylpurine-6,8-diamine |
| SMILES | CC(C)n1c(Nc2ncccn2)nc2c(NCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C19H20N8/c1-13(2)27-17-15(25-19(27)26-18-20-9-6-10-21-18)16(23-12-24-17)22-11-14-7-4-3-5-8-14/h3-10,12-13H,11H2,1-2H3,(H,22,23,24)(H,20,21,25,26) |
| InChIKey | BQKZLBXSUFDYAP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |