C23H26N6O3 — CID 117092444
8-N-phenyl-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-6,8-diamine (PubChem CID 117092444) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 8-N-phenyl-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-6,8-diamine.
| Compound Name | 8-N-phenyl-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-6,8-diamine |
|---|---|
| PubChem CID | 117092444 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 8-N-phenyl-9-propan-2-yl-6-N-(3,4,5-trimethoxyphenyl)purine-6,8-diamine |
| SMILES | COc1cc(Nc2ncnc3c2nc(Nc2ccccc2)n3C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C23H26N6O3/c1-14(2)29-22-19(28-23(29)27-15-9-7-6-8-10-15)21(24-13-25-22)26-16-11-17(30-3)20(32-5)18(12-16)31-4/h6-14H,1-5H3,(H,27,28)(H,24,25,26) |
| InChIKey | INECVKUQWSTARD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |