C24H28N2O6 — CID 171934003
1-N,2-N-bis(3,4,5-trimethoxyphenyl)benzene-1,2-diamine (PubChem CID 171934003) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-N,2-N-bis(3,4,5-trimethoxyphenyl)benzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis(3,4,5-trimethoxyphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 171934003 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-N,2-N-bis(3,4,5-trimethoxyphenyl)benzene-1,2-diamine |
| SMILES | COc1cc(Nc2ccccc2Nc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H28N2O6/c1-27-19-11-15(12-20(28-2)23(19)31-5)25-17-9-7-8-10-18(17)26-16-13-21(29-3)24(32-6)22(14-16)30-4/h7-14,25-26H,1-6H3 |
| InChIKey | OKIVHLPQEREVHH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |