C17H19NO6 — CID 171920024
7-methoxy-N-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-4-amine (PubChem CID 171920024) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 7-methoxy-N-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-4-amine.
| Compound Name | 7-methoxy-N-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-4-amine |
|---|---|
| PubChem CID | 171920024 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 7-methoxy-N-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-4-amine |
| SMILES | COc1cc(Nc2ccc(OC)c3c2OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO6/c1-19-12-6-5-11(15-17(12)24-9-23-15)18-10-7-13(20-2)16(22-4)14(8-10)21-3/h5-8,18H,9H2,1-4H3 |
| InChIKey | JNFNVNJPDMZMEI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |