C16H17NO5 — CID 171920112
N-(2,3,4-trimethoxyphenyl)-1,3-benzodioxol-4-amine (PubChem CID 171920112) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is N-(2,3,4-trimethoxyphenyl)-1,3-benzodioxol-4-amine.
| Compound Name | N-(2,3,4-trimethoxyphenyl)-1,3-benzodioxol-4-amine |
|---|---|
| PubChem CID | 171920112 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(2,3,4-trimethoxyphenyl)-1,3-benzodioxol-4-amine |
| SMILES | COc1ccc(Nc2cccc3c2OCO3)c(OC)c1OC |
| InChI | InChI=1S/C16H17NO5/c1-18-12-8-7-11(15(19-2)16(12)20-3)17-10-5-4-6-13-14(10)22-9-21-13/h4-8,17H,9H2,1-3H3 |
| InChIKey | CRRSINHQQZUVPI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |