C15H15NO3 — CID 171920461
N-(2-methoxy-3-methylphenyl)-1,3-benzodioxol-4-amine (PubChem CID 171920461) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-(2-methoxy-3-methylphenyl)-1,3-benzodioxol-4-amine.
| Compound Name | N-(2-methoxy-3-methylphenyl)-1,3-benzodioxol-4-amine |
|---|---|
| PubChem CID | 171920461 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(2-methoxy-3-methylphenyl)-1,3-benzodioxol-4-amine |
| SMILES | COc1c(C)cccc1Nc1cccc2c1OCO2 |
| InChI | InChI=1S/C15H15NO3/c1-10-5-3-6-11(14(10)17-2)16-12-7-4-8-13-15(12)19-9-18-13/h3-8,16H,9H2,1-2H3 |
| InChIKey | MZBRLOYKGIYIQH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |