C12H15NO2 — CID 164539583
N-(cyclobutylmethyl)-1,3-benzodioxol-4-amine (PubChem CID 164539583) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-1,3-benzodioxol-4-amine.
| Compound Name | N-(cyclobutylmethyl)-1,3-benzodioxol-4-amine |
|---|---|
| PubChem CID | 164539583 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-(cyclobutylmethyl)-1,3-benzodioxol-4-amine |
| SMILES | c1cc(NCC2CCC2)c2c(c1)OCO2 |
| InChI | InChI=1S/C12H15NO2/c1-3-9(4-1)7-13-10-5-2-6-11-12(10)15-8-14-11/h2,5-6,9,13H,1,3-4,7-8H2 |
| InChIKey | PMOWXMPPHWKBGO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |