About N-(cyclobutylmethyl)-2,3-dimethylaniline
N-(cyclobutylmethyl)-2,3-dimethylaniline (PubChem CID 65458031) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2,3-dimethylaniline.
Molecular Properties
| Compound Name | N-(cyclobutylmethyl)-2,3-dimethylaniline |
| PubChem CID | 65458031 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-(cyclobutylmethyl)-2,3-dimethylaniline |
| SMILES | Cc1cccc(NCC2CCC2)c1C |
| InChI | InChI=1S/C13H19N/c1-10-5-3-8-13(11(10)2)14-9-12-6-4-7-12/h3,5,8,12,14H,4,6-7,9H2,1-2H3 |
| InChIKey | BUSWSUXSXFXHEA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclobutylmethyl)-2,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclobutylmethyl)-2,3-dimethylaniline?
The IUPAC name of N-(cyclobutylmethyl)-2,3-dimethylaniline (CID 65458031) is N-(cyclobutylmethyl)-2,3-dimethylaniline.
What is the SMILES notation for N-(cyclobutylmethyl)-2,3-dimethylaniline?
The canonical SMILES for N-(cyclobutylmethyl)-2,3-dimethylaniline is Cc1cccc(NCC2CCC2)c1C.
What is the InChIKey of N-(cyclobutylmethyl)-2,3-dimethylaniline?
The InChIKey is BUSWSUXSXFXHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-10-5-3-8-13(11(10)2)14-9-12-6-4-7-12/h3,5,8,12,14H,4,6-7,9H2,1-2H3.
What are the key properties of N-(cyclobutylmethyl)-2,3-dimethylaniline?
N-(cyclobutylmethyl)-2,3-dimethylaniline has a molecular weight of 189.30 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclobutylmethyl)-2,3-dimethylaniline is sourced from PubChem (CID 65458031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).