About 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine
2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine (PubChem CID 87397533) has the molecular formula C7H6F2N2O2
and a molecular weight of 188.13 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine |
| PubChem CID | 87397533 |
| Molecular Formula | C7H6F2N2O2 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine |
| SMILES | FN(F)Nc1cccc2c1OCO2 |
| InChI | InChI=1S/C7H6F2N2O2/c8-11(9)10-5-2-1-3-6-7(5)13-4-12-6/h1-3,10H,4H2 |
| InChIKey | CGSYKEGOVWIHLD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine?
The IUPAC name of 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine (CID 87397533) is 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine.
What is the SMILES notation for 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine?
The canonical SMILES for 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine is FN(F)Nc1cccc2c1OCO2.
What is the InChIKey of 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine?
The InChIKey is CGSYKEGOVWIHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N2O2/c8-11(9)10-5-2-1-3-6-7(5)13-4-12-6/h1-3,10H,4H2.
What are the key properties of 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine?
2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine has a molecular weight of 188.13 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-4-yl)-1,1-difluorohydrazine is sourced from PubChem (CID 87397533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).