C8H7BrO2 — CID 22505967
4-(bromomethyl)-1,3-benzodioxole (PubChem CID 22505967) has the molecular formula C8H7BrO2 and a molecular weight of 215.05 g/mol. Its IUPAC name is 4-(bromomethyl)-1,3-benzodioxole.
| Compound Name | 4-(bromomethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 22505967 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 4-(bromomethyl)-1,3-benzodioxole |
| SMILES | BrCc1cccc2c1OCO2 |
| InChI | InChI=1S/C8H7BrO2/c9-4-6-2-1-3-7-8(6)11-5-10-7/h1-3H,4-5H2 |
| InChIKey | NXSORIZRMNGQNL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|