C12H17NO2 — CID 101045626
1-(1,3-benzodioxol-4-yl)-N,N-dimethylpropan-2-amine (PubChem CID 101045626) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-4-yl)-N,N-dimethylpropan-2-amine.
| Compound Name | 1-(1,3-benzodioxol-4-yl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 101045626 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-(1,3-benzodioxol-4-yl)-N,N-dimethylpropan-2-amine |
| SMILES | CC(Cc1cccc2c1OCO2)N(C)C |
| InChI | InChI=1S/C12H17NO2/c1-9(13(2)3)7-10-5-4-6-11-12(10)15-8-14-11/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | JDMYLMMSBHAOJH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |