About N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride
N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride (PubChem CID 154879529) has the molecular formula C9H10FNO4S
and a molecular weight of 247.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride.
Analyze N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
The IUPAC name of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride (CID 154879529) is N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride.
What is the SMILES notation for N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
The canonical SMILES for N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride is CN(Cc1cccc2c1OCO2)S(=O)(=O)F.
What is the InChIKey of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
The InChIKey is XHMKKDMGLGFPPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO4S/c1-11(16(10,12)13)5-7-3-2-4-8-9(7)15-6-14-8/h2-4H,5-6H2,1H3.
What are the key properties of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride has a molecular weight of 247.25 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride is sourced from PubChem (CID 154879529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).