About N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride
N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride (PubChem CID 154879529) has the molecular formula C9H10FNO4S
and a molecular weight of 247.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride |
| PubChem CID | 154879529 |
| Molecular Formula | C9H10FNO4S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride |
| SMILES | CN(Cc1cccc2c1OCO2)S(=O)(=O)F |
| InChI | InChI=1S/C9H10FNO4S/c1-11(16(10,12)13)5-7-3-2-4-8-9(7)15-6-14-8/h2-4H,5-6H2,1H3 |
| InChIKey | XHMKKDMGLGFPPI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
The IUPAC name of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride (CID 154879529) is N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride.
What is the SMILES notation for N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
The canonical SMILES for N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride is CN(Cc1cccc2c1OCO2)S(=O)(=O)F.
What is the InChIKey of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
The InChIKey is XHMKKDMGLGFPPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO4S/c1-11(16(10,12)13)5-7-3-2-4-8-9(7)15-6-14-8/h2-4H,5-6H2,1H3.
What are the key properties of N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride?
N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride has a molecular weight of 247.25 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-4-ylmethyl)-N-methylsulfamoyl fluoride is sourced from PubChem (CID 154879529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).