C11H12N2O5 — CID 122089295
3-(1,3-benzodioxol-4-ylcarbamoylamino)propanoic acid (PubChem CID 122089295) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-ylcarbamoylamino)propanoic acid.
| Compound Name | 3-(1,3-benzodioxol-4-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 122089295 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-(1,3-benzodioxol-4-ylcarbamoylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)Nc1cccc2c1OCO2 |
| InChI | InChI=1S/C11H12N2O5/c14-9(15)4-5-12-11(16)13-7-2-1-3-8-10(7)18-6-17-8/h1-3H,4-6H2,(H,14,15)(H2,12,13,16) |
| InChIKey | VRNYPZSYVWOOPO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |