C9H8N2O4 — CID 166889788
(2E)-N-(1,3-benzodioxol-4-yl)-2-hydroxyiminoacetamide (PubChem CID 166889788) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is (2E)-N-(1,3-benzodioxol-4-yl)-2-hydroxyiminoacetamide.
| Compound Name | (2E)-N-(1,3-benzodioxol-4-yl)-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 166889788 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (2E)-N-(1,3-benzodioxol-4-yl)-2-hydroxyiminoacetamide |
| SMILES | O=C(/C=N/O)Nc1cccc2c1OCO2 |
| InChI | InChI=1S/C9H8N2O4/c12-8(4-10-13)11-6-2-1-3-7-9(6)15-5-14-7/h1-4,13H,5H2,(H,11,12)/b10-4+ |
| InChIKey | WJZQLYZAIGSJDW-ONNFQVAWSA-N |
| XLogP | 0.81 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|