C17H11ClN2O3 — CID 166360312
N-(1,3-benzodioxol-4-yl)-8-chloroisoquinoline-4-carboxamide (PubChem CID 166360312) has the molecular formula C17H11ClN2O3 and a molecular weight of 326.74 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-yl)-8-chloroisoquinoline-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-4-yl)-8-chloroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 166360312 |
| Molecular Formula | C17H11ClN2O3 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-(1,3-benzodioxol-4-yl)-8-chloroisoquinoline-4-carboxamide |
| SMILES | O=C(Nc1cccc2c1OCO2)c1cncc2c(Cl)cccc12 |
| InChI | InChI=1S/C17H11ClN2O3/c18-13-4-1-3-10-11(13)7-19-8-12(10)17(21)20-14-5-2-6-15-16(14)23-9-22-15/h1-8H,9H2,(H,20,21) |
| InChIKey | UASZMDRGEYTKAK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |