C16H14ClNO3 — CID 110851438
2-(1,3-benzodioxol-4-yl)-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 110851438) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-4-yl)-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-4-yl)-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 110851438 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(1,3-benzodioxol-4-yl)-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | O=C(Cc1cccc2c1OCO2)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClNO3/c17-13-6-4-11(5-7-13)9-18-15(19)8-12-2-1-3-14-16(12)21-10-20-14/h1-7H,8-10H2,(H,18,19) |
| InChIKey | YEBFHGANUPLYSK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |