C13H16ClNO3 — CID 61210400
N-(1,3-benzodioxol-4-ylmethyl)-5-chloropentanamide (PubChem CID 61210400) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-5-chloropentanamide.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-5-chloropentanamide |
|---|---|
| PubChem CID | 61210400 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-5-chloropentanamide |
| SMILES | O=C(CCCCCl)NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C13H16ClNO3/c14-7-2-1-6-12(16)15-8-10-4-3-5-11-13(10)18-9-17-11/h3-5H,1-2,6-9H2,(H,15,16) |
| InChIKey | RQBCAEPAXMMKMD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|