C28H18Cl2N2O4 — CID 100999874
2-chloro-N-[5-[(2-chlorobenzoyl)amino]-9,10-dihydroxyanthracen-1-yl]benzamide (PubChem CID 100999874) has the molecular formula C28H18Cl2N2O4 and a molecular weight of 517.37 g/mol. Its IUPAC name is 2-chloro-N-[5-[(2-chlorobenzoyl)amino]-9,10-dihydroxyanthracen-1-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[(2-chlorobenzoyl)amino]-9,10-dihydroxyanthracen-1-yl]benzamide |
|---|---|
| PubChem CID | 100999874 |
| Molecular Formula | C28H18Cl2N2O4 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 2-chloro-N-[5-[(2-chlorobenzoyl)amino]-9,10-dihydroxyanthracen-1-yl]benzamide |
| SMILES | O=C(Nc1cccc2c(O)c3c(NC(=O)c4ccccc4Cl)cccc3c(O)c12)c1ccccc1Cl |
| InChI | InChI=1S/C28H18Cl2N2O4/c29-19-11-3-1-7-15(19)27(35)31-21-13-5-9-17-23(21)25(33)18-10-6-14-22(24(18)26(17)34)32-28(36)16-8-2-4-12-20(16)30/h1-14,33-34H,(H,31,35)(H,32,36) |
| InChIKey | PDEGUFZNSOLTEO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|