C21H14ClNO3 — CID 86176763
3-chloro-N-(9,10-dihydroxyanthracen-1-yl)benzamide (PubChem CID 86176763) has the molecular formula C21H14ClNO3 and a molecular weight of 363.80 g/mol. Its IUPAC name is 3-chloro-N-(9,10-dihydroxyanthracen-1-yl)benzamide.
| Compound Name | 3-chloro-N-(9,10-dihydroxyanthracen-1-yl)benzamide |
|---|---|
| PubChem CID | 86176763 |
| Molecular Formula | C21H14ClNO3 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-chloro-N-(9,10-dihydroxyanthracen-1-yl)benzamide |
| SMILES | O=C(Nc1cccc2c(O)c3ccccc3c(O)c12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H14ClNO3/c22-13-6-3-5-12(11-13)21(26)23-17-10-4-9-16-18(17)20(25)15-8-2-1-7-14(15)19(16)24/h1-11,24-25H,(H,23,26) |
| InChIKey | DQXXPKIJQCDJGL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|