C39H27N3O3 — CID 141408236
N-(5,9-dibenzamidotriphenylen-1-yl)benzamide (PubChem CID 141408236) has the molecular formula C39H27N3O3 and a molecular weight of 585.66 g/mol. Its IUPAC name is N-(5,9-dibenzamidotriphenylen-1-yl)benzamide.
| Compound Name | N-(5,9-dibenzamidotriphenylen-1-yl)benzamide |
|---|---|
| PubChem CID | 141408236 |
| Molecular Formula | C39H27N3O3 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | N-(5,9-dibenzamidotriphenylen-1-yl)benzamide |
| SMILES | O=C(Nc1cccc2c1c1cccc(NC(=O)c3ccccc3)c1c1cccc(NC(=O)c3ccccc3)c21)c1ccccc1 |
| InChI | InChI=1S/C39H27N3O3/c43-37(25-13-4-1-5-14-25)40-31-22-10-19-28-34(31)29-20-11-23-32(41-38(44)26-15-6-2-7-16-26)36(29)30-21-12-24-33(35(28)30)42-39(45)27-17-8-3-9-18-27/h1-24H,(H,40,43)(H,41,44)(H,42,45) |
| InChIKey | WHQBQDXDWURHOS-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|