C14H9ClFNO3 — CID 110699491
N-(3-chloro-4-fluorophenyl)-1,3-benzodioxole-4-carboxamide (PubChem CID 110699491) has the molecular formula C14H9ClFNO3 and a molecular weight of 293.68 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 110699491 |
| Molecular Formula | C14H9ClFNO3 |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1,3-benzodioxole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C14H9ClFNO3/c15-10-6-8(4-5-11(10)16)17-14(18)9-2-1-3-12-13(9)20-7-19-12/h1-6H,7H2,(H,17,18) |
| InChIKey | BYEAXGHACBMZFY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |