C15H10F2INO3 — CID 60610928
N-(3,5-difluoro-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 60610928) has the molecular formula C15H10F2INO3 and a molecular weight of 417.15 g/mol. Its IUPAC name is N-(3,5-difluoro-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-(3,5-difluoro-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 60610928 |
| Molecular Formula | C15H10F2INO3 |
| Molecular Weight | 417.15 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | N-(3,5-difluoro-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | O=C(Nc1cc(F)c(I)c(F)c1)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H10F2INO3/c16-10-6-8(7-11(17)13(10)18)19-15(20)9-2-1-3-12-14(9)22-5-4-21-12/h1-3,6-7H,4-5H2,(H,19,20) |
| InChIKey | SPAXNDAUHGVIJX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|