C10H10N2O3 — CID 163477302
N-(methylideneamino)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 163477302) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is N-(methylideneamino)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-(methylideneamino)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 163477302 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-(methylideneamino)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | C=NNC(=O)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C10H10N2O3/c1-11-12-10(13)7-3-2-4-8-9(7)15-6-5-14-8/h2-4H,1,5-6H2,(H,12,13) |
| InChIKey | CBODBODOBXGYOM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|