About N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide
N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 47455792) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| PubChem CID | 47455792 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H13NO4/c17-12-6-2-1-5-11(12)16-15(18)10-4-3-7-13-14(10)20-9-8-19-13/h1-7,17H,8-9H2,(H,16,18) |
| InChIKey | QKPONNMZLDPOPD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide?
The IUPAC name of N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (CID 47455792) is N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
What is the SMILES notation for N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide?
The canonical SMILES for N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide is O=C(Nc1ccccc1O)c1cccc2c1OCCO2.
What is the InChIKey of N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide?
The InChIKey is QKPONNMZLDPOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c17-12-6-2-1-5-11(12)16-15(18)10-4-3-7-13-14(10)20-9-8-19-13/h1-7,17H,8-9H2,(H,16,18).
What are the key properties of N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide?
N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide has a molecular weight of 271.27 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyphenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide is sourced from PubChem (CID 47455792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).