C10H10N2O3 — CID 117065761
(2E)-N-(2,3-dihydro-1-benzofuran-4-yl)-2-hydroxyiminoacetamide (PubChem CID 117065761) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2E)-N-(2,3-dihydro-1-benzofuran-4-yl)-2-hydroxyiminoacetamide.
| Compound Name | (2E)-N-(2,3-dihydro-1-benzofuran-4-yl)-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 117065761 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (2E)-N-(2,3-dihydro-1-benzofuran-4-yl)-2-hydroxyiminoacetamide |
| SMILES | O=C(/C=N/O)Nc1cccc2c1CCO2 |
| InChI | InChI=1S/C10H10N2O3/c13-10(6-11-14)12-8-2-1-3-9-7(8)4-5-15-9/h1-3,6,14H,4-5H2,(H,12,13)/b11-6+ |
| InChIKey | OQBZUVNZQGZHSP-IZZDOVSWSA-N |
| XLogP | 1.02 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|