C16H18N2O4 — CID 172896047
(2R)-N-(1,3-benzodioxol-4-yl)-2-methyl-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 172896047) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-4-yl)-2-methyl-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-4-yl)-2-methyl-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 172896047 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-4-yl)-2-methyl-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@]1(C)C(=O)Nc1cccc2c1OCO2 |
| InChI | InChI=1S/C16H18N2O4/c1-3-13(19)18-9-5-8-16(18,2)15(20)17-11-6-4-7-12-14(11)22-10-21-12/h3-4,6-7H,1,5,8-10H2,2H3,(H,17,20)/t16-/m1/s1 |
| InChIKey | OECHALSTMZNGCO-MRXNPFEDSA-N |
| XLogP | 1.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|