C10H12O4 — CID 59720306
4,5-dimethoxy-6-methyl-1,3-benzodioxole (PubChem CID 59720306) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 4,5-dimethoxy-6-methyl-1,3-benzodioxole.
| Compound Name | 4,5-dimethoxy-6-methyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 59720306 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4,5-dimethoxy-6-methyl-1,3-benzodioxole |
| SMILES | COc1c(C)cc2c(c1OC)OCO2 |
| InChI | InChI=1S/C10H12O4/c1-6-4-7-9(14-5-13-7)10(12-3)8(6)11-2/h4H,5H2,1-3H3 |
| InChIKey | BGZFYQFOBWRILS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |