C13H14NO3+ — CID 27151
6-ethyl-4-methoxy-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 27151) has the molecular formula C13H14NO3+ and a molecular weight of 232.26 g/mol. Its IUPAC name is 6-ethyl-4-methoxy-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 6-ethyl-4-methoxy-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 27151 |
| Molecular Formula | C13H14NO3+ |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 6-ethyl-4-methoxy-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | CC[n+]1ccc2cc3c(c(OC)c2c1)OCO3 |
| InChI | InChI=1S/C13H14NO3/c1-3-14-5-4-9-6-11-13(17-8-16-11)12(15-2)10(9)7-14/h4-7H,3,8H2,1-2H3/q+1 |
| InChIKey | WMHMVPDWHITQSQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|