C8H6ClFO5S — CID 84712248
6-fluoro-5-methoxy-1,3-benzodioxole-4-sulfonyl chloride (PubChem CID 84712248) has the molecular formula C8H6ClFO5S and a molecular weight of 268.65 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-1,3-benzodioxole-4-sulfonyl chloride.
| Compound Name | 6-fluoro-5-methoxy-1,3-benzodioxole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 84712248 |
| Molecular Formula | C8H6ClFO5S |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 6-fluoro-5-methoxy-1,3-benzodioxole-4-sulfonyl chloride |
| SMILES | COc1c(F)cc2c(c1S(=O)(=O)Cl)OCO2 |
| InChI | InChI=1S/C8H6ClFO5S/c1-13-6-4(10)2-5-7(15-3-14-5)8(6)16(9,11)12/h2H,3H2,1H3 |
| InChIKey | RXRKLZVAUGMOND-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |