C10H12FNO4 — CID 117329917
O-[2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)ethyl]hydroxylamine (PubChem CID 117329917) has the molecular formula C10H12FNO4 and a molecular weight of 229.21 g/mol. Its IUPAC name is O-[2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117329917 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | O-[2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)ethyl]hydroxylamine |
| SMILES | COc1c(F)cc2c(c1CCON)OCO2 |
| InChI | InChI=1S/C10H12FNO4/c1-13-9-6(2-3-16-12)10-8(4-7(9)11)14-5-15-10/h4H,2-3,5,12H2,1H3 |
| InChIKey | ARYRCEYBADSJGJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|