C11H14FNO3 — CID 117326589
3-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)propan-1-amine (PubChem CID 117326589) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is 3-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)propan-1-amine.
| Compound Name | 3-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 117326589 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)propan-1-amine |
| SMILES | COc1c(F)cc2c(c1CCCN)OCO2 |
| InChI | InChI=1S/C11H14FNO3/c1-14-10-7(3-2-4-13)11-9(5-8(10)12)15-6-16-11/h5H,2-4,6,13H2,1H3 |
| InChIKey | IHOVKFSPPLFUQG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |