C12H16FNO3 — CID 117354821
3-(7-fluoro-6-methoxy-1,3-benzodioxol-5-yl)butan-1-amine (PubChem CID 117354821) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is 3-(7-fluoro-6-methoxy-1,3-benzodioxol-5-yl)butan-1-amine.
| Compound Name | 3-(7-fluoro-6-methoxy-1,3-benzodioxol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 117354821 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-(7-fluoro-6-methoxy-1,3-benzodioxol-5-yl)butan-1-amine |
| SMILES | COc1c(C(C)CCN)cc2c(c1F)OCO2 |
| InChI | InChI=1S/C12H16FNO3/c1-7(3-4-14)8-5-9-12(17-6-16-9)10(13)11(8)15-2/h5,7H,3-4,6,14H2,1-2H3 |
| InChIKey | JHVWLERTEDRQJP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |