C10H12FNO2 — CID 117286816
2-(7-fluoro-1,3-benzodioxol-5-yl)propan-1-amine (PubChem CID 117286816) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-(7-fluoro-1,3-benzodioxol-5-yl)propan-1-amine.
| Compound Name | 2-(7-fluoro-1,3-benzodioxol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 117286816 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-(7-fluoro-1,3-benzodioxol-5-yl)propan-1-amine |
| SMILES | CC(CN)c1cc(F)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H12FNO2/c1-6(4-12)7-2-8(11)10-9(3-7)13-5-14-10/h2-3,6H,4-5,12H2,1H3 |
| InChIKey | VWVANLJYARDQLW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |