C12H15F2NO2 — CID 117359470
4-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]butan-1-amine (PubChem CID 117359470) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 4-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]butan-1-amine.
| Compound Name | 4-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 117359470 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]butan-1-amine |
| SMILES | NCCCCc1cc(C(F)F)cc2c1OCO2 |
| InChI | InChI=1S/C12H15F2NO2/c13-12(14)9-5-8(3-1-2-4-15)11-10(6-9)16-7-17-11/h5-6,12H,1-4,7,15H2 |
| InChIKey | DMIWZOGKGBNURQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|