C13H15FO4 — CID 117388533
4-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]butanoic acid (PubChem CID 117388533) has the molecular formula C13H15FO4 and a molecular weight of 254.26 g/mol. Its IUPAC name is 4-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]butanoic acid.
| Compound Name | 4-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 117388533 |
| Molecular Formula | C13H15FO4 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 4-[6-(1-fluoroethyl)-1,3-benzodioxol-4-yl]butanoic acid |
| SMILES | CC(F)c1cc(CCCC(=O)O)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H15FO4/c1-8(14)10-5-9(3-2-4-12(15)16)13-11(6-10)17-7-18-13/h5-6,8H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | VFDUDNBBEBBMMN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |