C10H8F2O4 — CID 84693299
2-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]acetic acid (PubChem CID 84693299) has the molecular formula C10H8F2O4 and a molecular weight of 230.17 g/mol. Its IUPAC name is 2-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]acetic acid.
| Compound Name | 2-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]acetic acid |
|---|---|
| PubChem CID | 84693299 |
| Molecular Formula | C10H8F2O4 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-[6-(difluoromethyl)-1,3-benzodioxol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)F)cc2c1OCO2 |
| InChI | InChI=1S/C10H8F2O4/c11-10(12)6-1-5(3-8(13)14)9-7(2-6)15-4-16-9/h1-2,10H,3-4H2,(H,13,14) |
| InChIKey | TXFSJEUJUMYRQN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |