C8H5ClF2O4S — CID 84712749
6-(difluoromethyl)-1,3-benzodioxole-4-sulfonyl chloride (PubChem CID 84712749) has the molecular formula C8H5ClF2O4S and a molecular weight of 270.64 g/mol. Its IUPAC name is 6-(difluoromethyl)-1,3-benzodioxole-4-sulfonyl chloride.
| Compound Name | 6-(difluoromethyl)-1,3-benzodioxole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 84712749 |
| Molecular Formula | C8H5ClF2O4S |
| Molecular Weight | 270.64 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 6-(difluoromethyl)-1,3-benzodioxole-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(C(F)F)cc2c1OCO2 |
| InChI | InChI=1S/C8H5ClF2O4S/c9-16(12,13)6-2-4(8(10)11)1-5-7(6)15-3-14-5/h1-2,8H,3H2 |
| InChIKey | QHORERZKIGTXTA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |