C12H14ClNO5S — CID 83272082
6-(morpholin-4-ylmethyl)-1,3-benzodioxole-4-sulfonyl chloride (PubChem CID 83272082) has the molecular formula C12H14ClNO5S and a molecular weight of 319.77 g/mol. Its IUPAC name is 6-(morpholin-4-ylmethyl)-1,3-benzodioxole-4-sulfonyl chloride.
| Compound Name | 6-(morpholin-4-ylmethyl)-1,3-benzodioxole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 83272082 |
| Molecular Formula | C12H14ClNO5S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 6-(morpholin-4-ylmethyl)-1,3-benzodioxole-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(CN2CCOCC2)cc2c1OCO2 |
| InChI | InChI=1S/C12H14ClNO5S/c13-20(15,16)11-6-9(5-10-12(11)19-8-18-10)7-14-1-3-17-4-2-14/h5-6H,1-4,7-8H2 |
| InChIKey | LQYXVUIGVHFXEG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |